About ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate
ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate (PubChem CID 113317141) has the molecular formula C11H23NO5S
and a molecular weight of 281.37 g/mol. Its IUPAC name is ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate.
Analyze ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate?
The IUPAC name of ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate (CID 113317141) is ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate.
What is the SMILES notation for ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate?
The canonical SMILES for ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate is CCOC(=O)CS(=O)(=O)NC(CCO)C(C)(C)C.
What is the InChIKey of ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate?
The InChIKey is JZYWACNGODUFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO5S/c1-5-17-10(14)8-18(15,16)12-9(6-7-13)11(2,3)4/h9,12-13H,5-8H2,1-4H3.
What are the key properties of ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate?
ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate has a molecular weight of 281.37 g/mol, XLogP of 0.27, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1-hydroxy-4,4-dimethylpentan-3-yl)sulfamoyl]acetate is sourced from PubChem (CID 113317141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).