C6H12F2N2O4S — CID 114383948
methyl 2-[(3-amino-2,2-difluoropropyl)sulfamoyl]acetate (PubChem CID 114383948) has the molecular formula C6H12F2N2O4S and a molecular weight of 246.23 g/mol. Its IUPAC name is methyl 2-[(3-amino-2,2-difluoropropyl)sulfamoyl]acetate.
| Compound Name | methyl 2-[(3-amino-2,2-difluoropropyl)sulfamoyl]acetate |
|---|---|
| PubChem CID | 114383948 |
| Molecular Formula | C6H12F2N2O4S |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | methyl 2-[(3-amino-2,2-difluoropropyl)sulfamoyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)NCC(F)(F)CN |
| InChI | InChI=1S/C6H12F2N2O4S/c1-14-5(11)2-15(12,13)10-4-6(7,8)3-9/h10H,2-4,9H2,1H3 |
| InChIKey | ZQZNEWHWYGPXIQ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |