C11H14F9NO2 — CID 71672156
hexyl N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamate (PubChem CID 71672156) has the molecular formula C11H14F9NO2 and a molecular weight of 363.22 g/mol. Its IUPAC name is hexyl N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamate.
| Compound Name | hexyl N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 71672156 |
| Molecular Formula | C11H14F9NO2 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | hexyl N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamate |
| SMILES | CCCCCCOC(=O)NC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H14F9NO2/c1-2-3-4-5-6-23-7(22)21-8(9(12,13)14,10(15,16)17)11(18,19)20/h2-6H2,1H3,(H,21,22) |
| InChIKey | UHDDPVHNSCADQL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|