C23H33BrO5Si — CID 11733768
methyl (2S,3R,4E,6E)-8-acetyloxy-2-(4-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxyocta-4,6-dienoate (PubChem CID 11733768) has the molecular formula C23H33BrO5Si and a molecular weight of 497.50 g/mol. Its IUPAC name is methyl (2S,3R,4E,6E)-8-acetyloxy-2-(4-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxyocta-4,6-dienoate.
| Compound Name | methyl (2S,3R,4E,6E)-8-acetyloxy-2-(4-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxyocta-4,6-dienoate |
|---|---|
| PubChem CID | 11733768 |
| Molecular Formula | C23H33BrO5Si |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | methyl (2S,3R,4E,6E)-8-acetyloxy-2-(4-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxyocta-4,6-dienoate |
| SMILES | COC(=O)[C@@H](c1ccc(Br)cc1)[C@@H](/C=C/C=C/COC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H33BrO5Si/c1-17(25)28-16-10-8-9-11-20(29-30(6,7)23(2,3)4)21(22(26)27-5)18-12-14-19(24)15-13-18/h8-15,20-21H,16H2,1-7H3/b10-8+,11-9+/t20-,21+/m1/s1 |
| InChIKey | DXIXQERQUUZUFT-HALRYLDBSA-N |
| XLogP | 5.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|