C21H32Br4O3Si — CID 133082102
2,2,2-tribromoethyl (2R,6S)-2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxyheptanoate (PubChem CID 133082102) has the molecular formula C21H32Br4O3Si and a molecular weight of 680.19 g/mol. Its IUPAC name is 2,2,2-tribromoethyl (2R,6S)-2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxyheptanoate.
| Compound Name | 2,2,2-tribromoethyl (2R,6S)-2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxyheptanoate |
|---|---|
| PubChem CID | 133082102 |
| Molecular Formula | C21H32Br4O3Si |
| Molecular Weight | 680.19 g/mol |
| Exact Mass | 675.89 |
| IUPAC Name | 2,2,2-tribromoethyl (2R,6S)-2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxyheptanoate |
| SMILES | C[C@@H](CCC[C@@H](C(=O)OCC(Br)(Br)Br)c1ccc(Br)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32Br4O3Si/c1-15(28-29(5,6)20(2,3)4)8-7-9-18(16-10-12-17(22)13-11-16)19(26)27-14-21(23,24)25/h10-13,15,18H,7-9,14H2,1-6H3/t15-,18+/m0/s1 |
| InChIKey | OTSRIOIMRIBBIA-MAUKXSAKSA-N |
| XLogP | 8.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.19 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|