C21H32BrCl3O3Si — CID 133082099
2,2,2-trichloroethyl (2S,5S)-2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanoate (PubChem CID 133082099) has the molecular formula C21H32BrCl3O3Si and a molecular weight of 546.83 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S,5S)-2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanoate.
| Compound Name | 2,2,2-trichloroethyl (2S,5S)-2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanoate |
|---|---|
| PubChem CID | 133082099 |
| Molecular Formula | C21H32BrCl3O3Si |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | 2,2,2-trichloroethyl (2S,5S)-2-(4-bromophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexanoate |
| SMILES | C[C@@H](CC[C@H](C(=O)OCC(Cl)(Cl)Cl)c1ccc(Br)cc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32BrCl3O3Si/c1-15(13-28-29(5,6)20(2,3)4)7-12-18(16-8-10-17(22)11-9-16)19(26)27-14-21(23,24)25/h8-11,15,18H,7,12-14H2,1-6H3/t15-,18-/m0/s1 |
| InChIKey | AOJYXOVRJNHJBS-YJBOKZPZSA-N |
| XLogP | 7.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|