C26H38ClNO2SeSi — CID 10506588
(2R,3R)-N-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-chlorophenyl)-2-(phenylselanylmethyl)propanamide (PubChem CID 10506588) has the molecular formula C26H38ClNO2SeSi and a molecular weight of 539.09 g/mol. Its IUPAC name is (2R,3R)-N-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-chlorophenyl)-2-(phenylselanylmethyl)propanamide.
| Compound Name | (2R,3R)-N-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-chlorophenyl)-2-(phenylselanylmethyl)propanamide |
|---|---|
| PubChem CID | 10506588 |
| Molecular Formula | C26H38ClNO2SeSi |
| Molecular Weight | 539.09 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | (2R,3R)-N-tert-butyl-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-chlorophenyl)-2-(phenylselanylmethyl)propanamide |
| SMILES | CC(C)(C)NC(=O)[C@H](C[Se]c1ccccc1)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H38ClNO2SeSi/c1-25(2,3)28-24(29)22(18-31-21-12-10-9-11-13-21)23(19-14-16-20(27)17-15-19)30-32(7,8)26(4,5)6/h9-17,22-23H,18H2,1-8H3,(H,28,29)/t22-,23+/m1/s1 |
| InChIKey | LFUJQVJEDJQKSW-PKTZIBPZSA-N |
| XLogP | 6.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.09 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|