C19H19FO2S3 — CID 154606066
[4-[(4-fluorophenyl)sulfanylcarbothioylsulfanylmethyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 154606066) has the molecular formula C19H19FO2S3 and a molecular weight of 394.56 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)sulfanylcarbothioylsulfanylmethyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(4-fluorophenyl)sulfanylcarbothioylsulfanylmethyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 154606066 |
| Molecular Formula | C19H19FO2S3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | [4-[(4-fluorophenyl)sulfanylcarbothioylsulfanylmethyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(CSC(=S)Sc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H19FO2S3/c1-19(2,3)17(21)22-15-8-4-13(5-9-15)12-24-18(23)25-16-10-6-14(20)7-11-16/h4-11H,12H2,1-3H3 |
| InChIKey | BYGNWPMXVDYILC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|