C9H10FNS2 — CID 131852205
(4-fluorophenyl) N,N-dimethylcarbamodithioate (PubChem CID 131852205) has the molecular formula C9H10FNS2 and a molecular weight of 215.32 g/mol. Its IUPAC name is (4-fluorophenyl) N,N-dimethylcarbamodithioate.
| Compound Name | (4-fluorophenyl) N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 131852205 |
| Molecular Formula | C9H10FNS2 |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | (4-fluorophenyl) N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C9H10FNS2/c1-11(2)9(12)13-8-5-3-7(10)4-6-8/h3-6H,1-2H3 |
| InChIKey | HLRWOKAVGOJEIF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|