C16H12ClF4NS2 — CID 162534860
[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-fluorophenyl] N,N-dimethylcarbamodithioate (PubChem CID 162534860) has the molecular formula C16H12ClF4NS2 and a molecular weight of 393.86 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)phenyl]-5-fluorophenyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)phenyl]-5-fluorophenyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 162534860 |
| Molecular Formula | C16H12ClF4NS2 |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)phenyl]-5-fluorophenyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)Sc1cc(F)ccc1-c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H12ClF4NS2/c1-22(2)15(23)24-14-8-10(18)4-5-11(14)12-7-9(16(19,20)21)3-6-13(12)17/h3-8H,1-2H3 |
| InChIKey | NSSYTSAMBCVCPV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|