About (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate
(8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate (PubChem CID 86035778) has the molecular formula C12H11ClN2S2
and a molecular weight of 282.82 g/mol. Its IUPAC name is (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate |
| PubChem CID | 86035778 |
| Molecular Formula | C12H11ClN2S2 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)Sc1cnc2c(Cl)cccc2c1 |
| InChI | InChI=1S/C12H11ClN2S2/c1-15(2)12(16)17-9-6-8-4-3-5-10(13)11(8)14-7-9/h3-7H,1-2H3 |
| InChIKey | GIIJPDBNRXMJNJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate?
The IUPAC name of (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate (CID 86035778) is (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate.
What is the SMILES notation for (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate?
The canonical SMILES for (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate is CN(C)C(=S)Sc1cnc2c(Cl)cccc2c1.
What is the InChIKey of (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate?
The InChIKey is GIIJPDBNRXMJNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2S2/c1-15(2)12(16)17-9-6-8-4-3-5-10(13)11(8)14-7-9/h3-7H,1-2H3.
What are the key properties of (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate?
(8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate has a molecular weight of 282.82 g/mol, XLogP of 3.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8-chloroquinolin-3-yl) N,N-dimethylcarbamodithioate is sourced from PubChem (CID 86035778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).