C29H29BF4N3- — CID 175823163
tetrakis(4-fluorophenyl)boranuide;1,1,3,3-tetramethylguanidine (PubChem CID 175823163) has the molecular formula C29H29BF4N3- and a molecular weight of 506.38 g/mol. Its IUPAC name is tetrakis(4-fluorophenyl)boranuide;1,1,3,3-tetramethylguanidine.
| Compound Name | tetrakis(4-fluorophenyl)boranuide;1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 175823163 |
| Molecular Formula | C29H29BF4N3- |
| Molecular Weight | 506.38 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | tetrakis(4-fluorophenyl)boranuide;1,1,3,3-tetramethylguanidine |
| SMILES | Fc1ccc([B-](c2ccc(F)cc2)(c2ccc(F)cc2)c2ccc(F)cc2)cc1.[H]N=C(N(C)C)N(C)C |
| InChI | InChI=1S/C24H16BF4.C5H13N3/c26-21-9-1-17(2-10-21)25(18-3-11-22(27)12-4-18,19-5-13-23(28)14-6-19)20-7-15-24(29)16-8-20;1-7(2)5(6)8(3)4/h1-16H;6H,1-4H3/q-1; |
| InChIKey | RXEFVQVBWNIDPL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|