About N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine
N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine (PubChem CID 77110886) has the molecular formula C11H15FN2
and a molecular weight of 194.25 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine.
Molecular Properties
| Compound Name | N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine |
| PubChem CID | 77110886 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine |
| SMILES | CN(CC=CCN)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FN2/c1-14(9-3-2-8-13)11-6-4-10(12)5-7-11/h2-7H,8-9,13H2,1H3 |
| InChIKey | KNYHDCRAFDFTRY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine?
The IUPAC name of N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine (CID 77110886) is N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine.
What is the SMILES notation for N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine?
The canonical SMILES for N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine is CN(CC=CCN)c1ccc(F)cc1.
What is the InChIKey of N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine?
The InChIKey is KNYHDCRAFDFTRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2/c1-14(9-3-2-8-13)11-6-4-10(12)5-7-11/h2-7H,8-9,13H2,1H3.
What are the key properties of N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine?
N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine has a molecular weight of 194.25 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-fluorophenyl)-N'-methylbut-2-ene-1,4-diamine is sourced from PubChem (CID 77110886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).