C13H21FN2 — CID 82682682
N'-(4-fluorophenyl)-N',2-dimethylpentane-1,5-diamine (PubChem CID 82682682) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N',2-dimethylpentane-1,5-diamine.
| Compound Name | N'-(4-fluorophenyl)-N',2-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 82682682 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | N'-(4-fluorophenyl)-N',2-dimethylpentane-1,5-diamine |
| SMILES | CC(CN)CCCN(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H21FN2/c1-11(10-15)4-3-9-16(2)13-7-5-12(14)6-8-13/h5-8,11H,3-4,9-10,15H2,1-2H3 |
| InChIKey | KKLDYXVLOHURPM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |