C13H21FN2O — CID 115203044
N'-(3-fluoro-4-methoxyphenyl)-N',2-dimethylbutane-1,4-diamine (PubChem CID 115203044) has the molecular formula C13H21FN2O and a molecular weight of 240.32 g/mol. Its IUPAC name is N'-(3-fluoro-4-methoxyphenyl)-N',2-dimethylbutane-1,4-diamine.
| Compound Name | N'-(3-fluoro-4-methoxyphenyl)-N',2-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115203044 |
| Molecular Formula | C13H21FN2O |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N'-(3-fluoro-4-methoxyphenyl)-N',2-dimethylbutane-1,4-diamine |
| SMILES | COc1ccc(N(C)CCC(C)CN)cc1F |
| InChI | InChI=1S/C13H21FN2O/c1-10(9-15)6-7-16(2)11-4-5-13(17-3)12(14)8-11/h4-5,8,10H,6-7,9,15H2,1-3H3 |
| InChIKey | FQSBHBKGUDRNSE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|