C31H38BN — CID 175771685
N,N-dimethylmethanamine;hydron;tetrakis(4-methylphenyl)boranuide (PubChem CID 175771685) has the molecular formula C31H38BN and a molecular weight of 435.46 g/mol. Its IUPAC name is N,N-dimethylmethanamine;hydron;tetrakis(4-methylphenyl)boranuide.
| Compound Name | N,N-dimethylmethanamine;hydron;tetrakis(4-methylphenyl)boranuide |
|---|---|
| PubChem CID | 175771685 |
| Molecular Formula | C31H38BN |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | N,N-dimethylmethanamine;hydron;tetrakis(4-methylphenyl)boranuide |
| SMILES | CN(C)C.Cc1ccc([B-](c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1.[H+] |
| InChI | InChI=1S/C28H28B.C3H9N/c1-21-5-13-25(14-6-21)29(26-15-7-22(2)8-16-26,27-17-9-23(3)10-18-27)28-19-11-24(4)12-20-28;1-4(2)3/h5-20H,1-4H3;1-3H3/q-1;/p+1 |
| InChIKey | IMAXQCGUYWLHIH-UHFFFAOYSA-O |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|