About 4-methylbenzenediazonium;tetraphenylboranuide
4-methylbenzenediazonium;tetraphenylboranuide (PubChem CID 10836747) has the molecular formula C31H27BN2
and a molecular weight of 438.38 g/mol. Its IUPAC name is 4-methylbenzenediazonium;tetraphenylboranuide.
Molecular Properties
| Compound Name | 4-methylbenzenediazonium;tetraphenylboranuide |
| PubChem CID | 10836747 |
| Molecular Formula | C31H27BN2 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 4-methylbenzenediazonium;tetraphenylboranuide |
| SMILES | Cc1ccc([N+]#N)cc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C7H7N2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-6-2-4-7(9-8)5-3-6/h1-20H;2-5H,1H3/q-1;+1 |
| InChIKey | RXWRSKJHYCGMNZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenediazonium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenediazonium;tetraphenylboranuide?
The IUPAC name of 4-methylbenzenediazonium;tetraphenylboranuide (CID 10836747) is 4-methylbenzenediazonium;tetraphenylboranuide.
What is the SMILES notation for 4-methylbenzenediazonium;tetraphenylboranuide?
The canonical SMILES for 4-methylbenzenediazonium;tetraphenylboranuide is Cc1ccc([N+]#N)cc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-methylbenzenediazonium;tetraphenylboranuide?
The InChIKey is RXWRSKJHYCGMNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C7H7N2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-6-2-4-7(9-8)5-3-6/h1-20H;2-5H,1H3/q-1;+1.
What are the key properties of 4-methylbenzenediazonium;tetraphenylboranuide?
4-methylbenzenediazonium;tetraphenylboranuide has a molecular weight of 438.38 g/mol, XLogP of 5.54, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenediazonium;tetraphenylboranuide is sourced from PubChem (CID 10836747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).