C21H25NO3S2 — CID 158046209
[4-[(4-methylphenyl)carbamothioylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 158046209) has the molecular formula C21H25NO3S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is [4-[(4-methylphenyl)carbamothioylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[(4-methylphenyl)carbamothioylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 158046209 |
| Molecular Formula | C21H25NO3S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [4-[(4-methylphenyl)carbamothioylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(NC(=S)SCc2ccc(OCOC(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H25NO3S2/c1-15-5-9-17(10-6-15)22-20(26)27-13-16-7-11-18(12-8-16)24-14-25-19(23)21(2,3)4/h5-12H,13-14H2,1-4H3,(H,22,26) |
| InChIKey | DFWDMPNOOOFMHT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|