C21H24O5S — CID 161088397
[4-[(4-methylphenoxy)carbothioyloxymethyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 161088397) has the molecular formula C21H24O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is [4-[(4-methylphenoxy)carbothioyloxymethyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[(4-methylphenoxy)carbothioyloxymethyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 161088397 |
| Molecular Formula | C21H24O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [4-[(4-methylphenoxy)carbothioyloxymethyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(OC(=S)OCc2ccc(OCOC(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H24O5S/c1-15-5-9-18(10-6-15)26-20(27)23-13-16-7-11-17(12-8-16)24-14-25-19(22)21(2,3)4/h5-12H,13-14H2,1-4H3 |
| InChIKey | LJKUGWAQNXKUDO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|