About [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate
[4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 132942229) has the molecular formula C20H21NO7S
and a molecular weight of 419.46 g/mol. Its IUPAC name is [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate |
| PubChem CID | 132942229 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOc1ccc(CSC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H21NO7S/c1-20(2,3)18(22)27-13-26-16-8-4-14(5-9-16)12-29-19(23)28-17-10-6-15(7-11-17)21(24)25/h4-11H,12-13H2,1-3H3 |
| InChIKey | CSCMQRMPRWDNCB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate?
The IUPAC name of [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate (CID 132942229) is [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate.
What is the SMILES notation for [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate?
The canonical SMILES for [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCOc1ccc(CSC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate?
The InChIKey is CSCMQRMPRWDNCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO7S/c1-20(2,3)18(22)27-13-26-16-8-4-14(5-9-16)12-29-19(23)28-17-10-6-15(7-11-17)21(24)25/h4-11H,12-13H2,1-3H3.
What are the key properties of [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate?
[4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate has a molecular weight of 419.46 g/mol, XLogP of 4.95, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-nitrophenoxy)carbonylsulfanylmethyl]phenoxy]methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 132942229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).