About (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate
(4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate (PubChem CID 174217270) has the molecular formula C14H14N2O6
and a molecular weight of 306.27 g/mol. Its IUPAC name is (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate |
| PubChem CID | 174217270 |
| Molecular Formula | C14H14N2O6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate |
| SMILES | Nc1ccc(CO)cc1.O=C(O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H5NO5.C7H9NO/c9-7(10)13-6-3-1-5(2-4-6)8(11)12;8-7-3-1-6(5-9)2-4-7/h1-4H,(H,9,10);1-4,9H,5,8H2 |
| InChIKey | YHDJLSFFZWDLFX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate?
The IUPAC name of (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate (CID 174217270) is (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate.
What is the SMILES notation for (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate?
The canonical SMILES for (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate is Nc1ccc(CO)cc1.O=C(O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate?
The InChIKey is YHDJLSFFZWDLFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO5.C7H9NO/c9-7(10)13-6-3-1-5(2-4-6)8(11)12;8-7-3-1-6(5-9)2-4-7/h1-4H,(H,9,10);1-4,9H,5,8H2.
What are the key properties of (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate?
(4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate has a molecular weight of 306.27 g/mol, XLogP of 2.41, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl)methanol;(4-nitrophenyl) hydrogen carbonate is sourced from PubChem (CID 174217270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).