C15H13Cl2NOS — CID 18209765
N-[4-[(3,4-dichlorophenyl)methylsulfanyl]phenyl]acetamide (PubChem CID 18209765) has the molecular formula C15H13Cl2NOS and a molecular weight of 326.25 g/mol. Its IUPAC name is N-[4-[(3,4-dichlorophenyl)methylsulfanyl]phenyl]acetamide.
| Compound Name | N-[4-[(3,4-dichlorophenyl)methylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 18209765 |
| Molecular Formula | C15H13Cl2NOS |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | N-[4-[(3,4-dichlorophenyl)methylsulfanyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H13Cl2NOS/c1-10(19)18-12-3-5-13(6-4-12)20-9-11-2-7-14(16)15(17)8-11/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | RFKUFQJVPCLLCA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |