C15H14Cl3N5 — CID 54323044
1-[amino-(4-chloroanilino)methylidene]-2-[(2,4-dichlorophenyl)methyl]guanidine (PubChem CID 54323044) has the molecular formula C15H14Cl3N5 and a molecular weight of 370.67 g/mol. Its IUPAC name is 1-[amino-(4-chloroanilino)methylidene]-2-[(2,4-dichlorophenyl)methyl]guanidine.
| Compound Name | 1-[amino-(4-chloroanilino)methylidene]-2-[(2,4-dichlorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 54323044 |
| Molecular Formula | C15H14Cl3N5 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 1-[amino-(4-chloroanilino)methylidene]-2-[(2,4-dichlorophenyl)methyl]guanidine |
| SMILES | NC(=N/C(N)=N/Cc1ccc(Cl)cc1Cl)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14Cl3N5/c16-10-3-5-12(6-4-10)22-15(20)23-14(19)21-8-9-1-2-11(17)7-13(9)18/h1-7H,8H2,(H5,19,20,21,22,23) |
| InChIKey | SSZCRPQCZOWYEZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|