C9H13BrClN5 — CID 11971697
2-[(4-bromophenyl)methyl]-1-(diaminomethylidene)guanidine;hydrochloride (PubChem CID 11971697) has the molecular formula C9H13BrClN5 and a molecular weight of 306.60 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1-(diaminomethylidene)guanidine;hydrochloride.
| Compound Name | 2-[(4-bromophenyl)methyl]-1-(diaminomethylidene)guanidine;hydrochloride |
|---|---|
| PubChem CID | 11971697 |
| Molecular Formula | C9H13BrClN5 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1-(diaminomethylidene)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/C(N)=N/Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H12BrN5.ClH/c10-7-3-1-6(2-4-7)5-14-9(13)15-8(11)12;/h1-4H,5H2,(H6,11,12,13,14,15);1H |
| InChIKey | SQFWKMHUHWLSCF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|