C10H14BrN5 — CID 118466297
2-[(4-bromo-3-methylphenyl)methyl]-1-(diaminomethylidene)guanidine (PubChem CID 118466297) has the molecular formula C10H14BrN5 and a molecular weight of 284.16 g/mol. Its IUPAC name is 2-[(4-bromo-3-methylphenyl)methyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[(4-bromo-3-methylphenyl)methyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 118466297 |
| Molecular Formula | C10H14BrN5 |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-[(4-bromo-3-methylphenyl)methyl]-1-(diaminomethylidene)guanidine |
| SMILES | Cc1cc(C/N=C(\N)N=C(N)N)ccc1Br |
| InChI | InChI=1S/C10H14BrN5/c1-6-4-7(2-3-8(6)11)5-15-10(14)16-9(12)13/h2-4H,5H2,1H3,(H6,12,13,14,15,16) |
| InChIKey | LPMGPUCZLUWQJU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|