C14H12BrCl2N3 — CID 130567686
2-benzyl-1-(4-bromo-2,6-dichlorophenyl)guanidine (PubChem CID 130567686) has the molecular formula C14H12BrCl2N3 and a molecular weight of 373.08 g/mol. Its IUPAC name is 2-benzyl-1-(4-bromo-2,6-dichlorophenyl)guanidine.
| Compound Name | 2-benzyl-1-(4-bromo-2,6-dichlorophenyl)guanidine |
|---|---|
| PubChem CID | 130567686 |
| Molecular Formula | C14H12BrCl2N3 |
| Molecular Weight | 373.08 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 2-benzyl-1-(4-bromo-2,6-dichlorophenyl)guanidine |
| SMILES | N/C(=N\Cc1ccccc1)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C14H12BrCl2N3/c15-10-6-11(16)13(12(17)7-10)20-14(18)19-8-9-4-2-1-3-5-9/h1-7H,8H2,(H3,18,19,20) |
| InChIKey | VSZCDLXIRCCJKX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.08 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|