C5H8N4OS — CID 104874351
1-hydroxy-2-(1,3-thiazol-5-ylmethyl)guanidine (PubChem CID 104874351) has the molecular formula C5H8N4OS and a molecular weight of 172.21 g/mol. Its IUPAC name is 1-hydroxy-2-(1,3-thiazol-5-ylmethyl)guanidine.
| Compound Name | 1-hydroxy-2-(1,3-thiazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 104874351 |
| Molecular Formula | C5H8N4OS |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 1-hydroxy-2-(1,3-thiazol-5-ylmethyl)guanidine |
| SMILES | N/C(=N\Cc1cncs1)NO |
| InChI | InChI=1S/C5H8N4OS/c6-5(9-10)8-2-4-1-7-3-11-4/h1,3,10H,2H2,(H3,6,8,9) |
| InChIKey | BCTUIBTVNDYYRE-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|