C20H26FIN4O — CID 111752459
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]guanidine;hydroiodide (PubChem CID 111752459) has the molecular formula C20H26FIN4O and a molecular weight of 484.36 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111752459 |
| Molecular Formula | C20H26FIN4O |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]guanidine;hydroiodide |
| SMILES | CN(CC/N=C(\N)NC1CCOc2ccccc21)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C20H25FN4O.HI/c1-25(14-15-6-8-16(21)9-7-15)12-11-23-20(22)24-18-10-13-26-19-5-3-2-4-17(18)19;/h2-9,18H,10-14H2,1H3,(H3,22,23,24);1H |
| InChIKey | KUXDFISDBJFFCY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|