C16H25IN6O2 — CID 111101564
1-(3-ethoxypropyl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide (PubChem CID 111101564) has the molecular formula C16H25IN6O2 and a molecular weight of 460.32 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxypropyl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111101564 |
| Molecular Formula | C16H25IN6O2 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(N)=N/Cc1nc(-c2ccc(OC)cc2)n[nH]1.I |
| InChI | InChI=1S/C16H24N6O2.HI/c1-3-24-10-4-9-18-16(17)19-11-14-20-15(22-21-14)12-5-7-13(23-2)8-6-12;/h5-8H,3-4,9-11H2,1-2H3,(H3,17,18,19)(H,20,21,22);1H |
| InChIKey | INTLCGBRMAMORM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|