C17H19IN6O — CID 111065973
1-(2-methoxyphenyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111065973) has the molecular formula C17H19IN6O and a molecular weight of 450.28 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyphenyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111065973 |
| Molecular Formula | C17H19IN6O |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccccc1N/C(N)=N/Cc1nncn1-c1ccccc1.I |
| InChI | InChI=1S/C17H18N6O.HI/c1-24-15-10-6-5-9-14(15)21-17(18)19-11-16-22-20-12-23(16)13-7-3-2-4-8-13;/h2-10,12H,11H2,1H3,(H3,18,19,21);1H |
| InChIKey | WUNMSYWJPJTUPR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|