C19H22N6O2 — CID 111066052
2-[(3,4-dimethoxyphenyl)methyl]-1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111066052) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111066052 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | COc1ccc(C/N=C(\N)NCc2nncn2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H22N6O2/c1-26-16-9-8-14(10-17(16)27-2)11-21-19(20)22-12-18-24-23-13-25(18)15-6-4-3-5-7-15/h3-10,13H,11-12H2,1-2H3,(H3,20,21,22) |
| InChIKey | IETHJJVQDLFESD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|