C23H34IN5O2 — CID 111061780
2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111061780) has the molecular formula C23H34IN5O2 and a molecular weight of 539.46 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111061780 |
| Molecular Formula | C23H34IN5O2 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(4-phenylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCC(C)N2CCN(c3ccccc3)CC2)cc1OC.I |
| InChI | InChI=1S/C23H33N5O2.HI/c1-18(27-11-13-28(14-12-27)20-7-5-4-6-8-20)16-25-23(24)26-17-19-9-10-21(29-2)22(15-19)30-3;/h4-10,15,18H,11-14,16-17H2,1-3H3,(H3,24,25,26);1H |
| InChIKey | ZJYAZMFYUNHUQT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|