C17H18F3NO3 — CID 2190599
(1S,5R)-1,8,8-trimethyl-3-[4-(trifluoromethoxy)phenyl]-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 2190599) has the molecular formula C17H18F3NO3 and a molecular weight of 341.33 g/mol. Its IUPAC name is (1S,5R)-1,8,8-trimethyl-3-[4-(trifluoromethoxy)phenyl]-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1S,5R)-1,8,8-trimethyl-3-[4-(trifluoromethoxy)phenyl]-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 2190599 |
| Molecular Formula | C17H18F3NO3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (1S,5R)-1,8,8-trimethyl-3-[4-(trifluoromethoxy)phenyl]-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)N(c1ccc(OC(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C17H18F3NO3/c1-15(2)12-8-9-16(15,3)14(23)21(13(12)22)10-4-6-11(7-5-10)24-17(18,19)20/h4-7,12H,8-9H2,1-3H3/t12-,16+/m0/s1 |
| InChIKey | GMIKYNQIGIBHLW-BLLLJJGKSA-N |
| XLogP | 3.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|