C15H19ClN2O2 — CID 143728934
3-(4-chlorophenyl)-1,3-diazaspiro[4.5]decane-2,4-dione;methane (PubChem CID 143728934) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,3-diazaspiro[4.5]decane-2,4-dione;methane.
| Compound Name | 3-(4-chlorophenyl)-1,3-diazaspiro[4.5]decane-2,4-dione;methane |
|---|---|
| PubChem CID | 143728934 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-(4-chlorophenyl)-1,3-diazaspiro[4.5]decane-2,4-dione;methane |
| SMILES | C.O=C1NC2(CCCCC2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H15ClN2O2.CH4/c15-10-4-6-11(7-5-10)17-12(18)14(16-13(17)19)8-2-1-3-9-14;/h4-7H,1-3,8-9H2,(H,16,19);1H4 |
| InChIKey | VMYRTSXRJVWDNE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|