C30H23NO4 — CID 98570638
ethyl 2-[(1R,12S,23S,27S)-24,26-dioxo-25-azaheptacyclo[10.10.5.02,11.03,8.013,22.014,19.023,27]heptacosa-2(11),3,5,7,9,13(22),14,16,18,20-decaen-25-yl]acetate (PubChem CID 98570638) has the molecular formula C30H23NO4 and a molecular weight of 461.52 g/mol. Its IUPAC name is ethyl 2-[(1R,12S,23S,27S)-24,26-dioxo-25-azaheptacyclo[10.10.5.02,11.03,8.013,22.014,19.023,27]heptacosa-2(11),3,5,7,9,13(22),14,16,18,20-decaen-25-yl]acetate.
| Compound Name | ethyl 2-[(1R,12S,23S,27S)-24,26-dioxo-25-azaheptacyclo[10.10.5.02,11.03,8.013,22.014,19.023,27]heptacosa-2(11),3,5,7,9,13(22),14,16,18,20-decaen-25-yl]acetate |
|---|---|
| PubChem CID | 98570638 |
| Molecular Formula | C30H23NO4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | ethyl 2-[(1R,12S,23S,27S)-24,26-dioxo-25-azaheptacyclo[10.10.5.02,11.03,8.013,22.014,19.023,27]heptacosa-2(11),3,5,7,9,13(22),14,16,18,20-decaen-25-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)[C@H]2[C@@H]3c4ccc5ccccc5c4[C@H](c4ccc5ccccc5c43)[C@@H]2C1=O |
| InChI | InChI=1S/C30H23NO4/c1-2-35-22(32)15-31-29(33)27-25-21-14-12-17-8-4-6-10-19(17)24(21)26(28(27)30(31)34)20-13-11-16-7-3-5-9-18(16)23(20)25/h3-14,25-28H,2,15H2,1H3/t25-,26+,27-,28-/m0/s1 |
| InChIKey | DDKPSUPQZFPBGK-PUHABZHSSA-N |
| XLogP | 4.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|