C19H22O3 — CID 141011131
ethyl 2-(1-methoxy-1,2,3,4-tetrahydrophenanthren-4-yl)acetate (PubChem CID 141011131) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl 2-(1-methoxy-1,2,3,4-tetrahydrophenanthren-4-yl)acetate.
| Compound Name | ethyl 2-(1-methoxy-1,2,3,4-tetrahydrophenanthren-4-yl)acetate |
|---|---|
| PubChem CID | 141011131 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | ethyl 2-(1-methoxy-1,2,3,4-tetrahydrophenanthren-4-yl)acetate |
| SMILES | CCOC(=O)CC1CCC(OC)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C19H22O3/c1-3-22-18(20)12-14-9-11-17(21-2)16-10-8-13-6-4-5-7-15(13)19(14)16/h4-8,10,14,17H,3,9,11-12H2,1-2H3 |
| InChIKey | MCFCKFOHJKGZFU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |