C14H17ClN4O4S — CID 38907605
(5-chlorothiadiazol-4-yl)methyl 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate (PubChem CID 38907605) has the molecular formula C14H17ClN4O4S and a molecular weight of 372.83 g/mol. Its IUPAC name is (5-chlorothiadiazol-4-yl)methyl 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate.
| Compound Name | (5-chlorothiadiazol-4-yl)methyl 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate |
|---|---|
| PubChem CID | 38907605 |
| Molecular Formula | C14H17ClN4O4S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (5-chlorothiadiazol-4-yl)methyl 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate |
| SMILES | O=C(CCN1C(=O)NC2(CCCCC2)C1=O)OCc1nnsc1Cl |
| InChI | InChI=1S/C14H17ClN4O4S/c15-11-9(17-18-24-11)8-23-10(20)4-7-19-12(21)14(16-13(19)22)5-2-1-3-6-14/h1-8H2,(H,16,22) |
| InChIKey | QCZPDARWYWKRBD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|