C17H19ClN2O5S — CID 8671671
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate (PubChem CID 8671671) has the molecular formula C17H19ClN2O5S and a molecular weight of 398.87 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
|---|---|
| PubChem CID | 8671671 |
| Molecular Formula | C17H19ClN2O5S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)NC2(CCCC2)C1=O)OCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H19ClN2O5S/c18-13-6-5-12(26-13)11(21)10-25-14(22)4-3-9-20-15(23)17(19-16(20)24)7-1-2-8-17/h5-6H,1-4,7-10H2,(H,19,24) |
| InChIKey | LDDHHHQJFZAMRX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|