C18H20Cl2N2O4 — CID 8671608
(3,4-dichlorophenyl)methyl 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate (PubChem CID 8671608) has the molecular formula C18H20Cl2N2O4 and a molecular weight of 399.27 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate.
| Compound Name | (3,4-dichlorophenyl)methyl 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
|---|---|
| PubChem CID | 8671608 |
| Molecular Formula | C18H20Cl2N2O4 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)NC2(CCCC2)C1=O)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2N2O4/c19-13-6-5-12(10-14(13)20)11-26-15(23)4-3-9-22-16(24)18(21-17(22)25)7-1-2-8-18/h5-6,10H,1-4,7-9,11H2,(H,21,25) |
| InChIKey | OCMOOECRYBWNBA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|