C19H16Cl2N2O4 — CID 7708848
(3,4-dichlorophenyl)methyl 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate (PubChem CID 7708848) has the molecular formula C19H16Cl2N2O4 and a molecular weight of 407.25 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate.
| Compound Name | (3,4-dichlorophenyl)methyl 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7708848 |
| Molecular Formula | C19H16Cl2N2O4 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetate |
| SMILES | C[C@]1(c2ccccc2)NC(=O)N(CC(=O)OCc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C19H16Cl2N2O4/c1-19(13-5-3-2-4-6-13)17(25)23(18(26)22-19)10-16(24)27-11-12-7-8-14(20)15(21)9-12/h2-9H,10-11H2,1H3,(H,22,26)/t19-/m1/s1 |
| InChIKey | RVMQJBSHZKSZJF-LJQANCHMSA-N |
| XLogP | 3.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|