C18H13Cl3N2O4 — CID 55335215
(2,4,6-trichlorophenyl) 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate (PubChem CID 55335215) has the molecular formula C18H13Cl3N2O4 and a molecular weight of 427.67 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate.
| Compound Name | (2,4,6-trichlorophenyl) 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55335215 |
| Molecular Formula | C18H13Cl3N2O4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | (2,4,6-trichlorophenyl) 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
| SMILES | CC1(c2ccccc2)NC(=O)N(CC(=O)Oc2c(Cl)cc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C18H13Cl3N2O4/c1-18(10-5-3-2-4-6-10)16(25)23(17(26)22-18)9-14(24)27-15-12(20)7-11(19)8-13(15)21/h2-8H,9H2,1H3,(H,22,26) |
| InChIKey | UGRIEIXFFDMFLT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|