C21H17ClFN3O5 — CID 55511616
(2-chloro-4-cyano-6-ethoxyphenyl) 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 55511616) has the molecular formula C21H17ClFN3O5 and a molecular weight of 445.83 g/mol. Its IUPAC name is (2-chloro-4-cyano-6-ethoxyphenyl) 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | (2-chloro-4-cyano-6-ethoxyphenyl) 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 55511616 |
| Molecular Formula | C21H17ClFN3O5 |
| Molecular Weight | 445.83 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (2-chloro-4-cyano-6-ethoxyphenyl) 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CCOc1cc(C#N)cc(Cl)c1OC(=O)CN1C(=O)NC(C)(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C21H17ClFN3O5/c1-3-30-16-9-12(10-24)8-15(22)18(16)31-17(27)11-26-19(28)21(2,25-20(26)29)13-4-6-14(23)7-5-13/h4-9H,3,11H2,1-2H3,(H,25,29) |
| InChIKey | RFZLLEIMIQXLPY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.83 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|