C19H16ClFN2O4 — CID 55510612
(4-chloro-2-methylphenyl) 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 55510612) has the molecular formula C19H16ClFN2O4 and a molecular weight of 390.80 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | (4-chloro-2-methylphenyl) 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 55510612 |
| Molecular Formula | C19H16ClFN2O4 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (4-chloro-2-methylphenyl) 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | Cc1cc(Cl)ccc1OC(=O)CN1C(=O)NC(C)(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C19H16ClFN2O4/c1-11-9-13(20)5-8-15(11)27-16(24)10-23-17(25)19(2,22-18(23)26)12-3-6-14(21)7-4-12/h3-9H,10H2,1-2H3,(H,22,26) |
| InChIKey | BVNPUWWLMQIXCK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|