C14H17ClN4O4S — CID 30975873
(5-chlorothiadiazol-4-yl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 30975873) has the molecular formula C14H17ClN4O4S and a molecular weight of 372.83 g/mol. Its IUPAC name is (5-chlorothiadiazol-4-yl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | (5-chlorothiadiazol-4-yl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 30975873 |
| Molecular Formula | C14H17ClN4O4S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (5-chlorothiadiazol-4-yl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@H]1CCCC[C@]12NC(=O)N(CC(=O)OCc1nnsc1Cl)C2=O |
| InChI | InChI=1S/C14H17ClN4O4S/c1-8-4-2-3-5-14(8)12(21)19(13(22)16-14)6-10(20)23-7-9-11(15)24-18-17-9/h8H,2-7H2,1H3,(H,16,22)/t8-,14-/m0/s1 |
| InChIKey | MCZJQSICWZJMGL-RTHLEPHNSA-N |
| XLogP | 1.74 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|