C21H25FN2O6 — CID 55374072
[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate (PubChem CID 55374072) has the molecular formula C21H25FN2O6 and a molecular weight of 420.44 g/mol. Its IUPAC name is [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate.
| Compound Name | [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 55374072 |
| Molecular Formula | C21H25FN2O6 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
| SMILES | COc1ccc(CN(C)C(=O)COC(=O)CN2C(=O)C3CCCCC3C2=O)cc1F |
| InChI | InChI=1S/C21H25FN2O6/c1-23(10-13-7-8-17(29-2)16(22)9-13)18(25)12-30-19(26)11-24-20(27)14-5-3-4-6-15(14)21(24)28/h7-9,14-15H,3-6,10-12H2,1-2H3 |
| InChIKey | UJMIFOPBKRCOTH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|