C18H20FNO4S — CID 55373457
[2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-thiophen-3-ylpropanoate (PubChem CID 55373457) has the molecular formula C18H20FNO4S and a molecular weight of 365.43 g/mol. Its IUPAC name is [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-thiophen-3-ylpropanoate.
| Compound Name | [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 55373457 |
| Molecular Formula | C18H20FNO4S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [2-[(3-fluoro-4-methoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-thiophen-3-ylpropanoate |
| SMILES | COc1ccc(CN(C)C(=O)COC(=O)CCc2ccsc2)cc1F |
| InChI | InChI=1S/C18H20FNO4S/c1-20(10-14-3-5-16(23-2)15(19)9-14)17(21)11-24-18(22)6-4-13-7-8-25-12-13/h3,5,7-9,12H,4,6,10-11H2,1-2H3 |
| InChIKey | RVAFOROWAGJRPC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |