C16H21Cl2NO2S — CID 39991988
N-cycloheptyl-2-[(S)-(2,4-dichlorophenyl)methylsulfinyl]acetamide (PubChem CID 39991988) has the molecular formula C16H21Cl2NO2S and a molecular weight of 362.32 g/mol. Its IUPAC name is N-cycloheptyl-2-[(S)-(2,4-dichlorophenyl)methylsulfinyl]acetamide.
| Compound Name | N-cycloheptyl-2-[(S)-(2,4-dichlorophenyl)methylsulfinyl]acetamide |
|---|---|
| PubChem CID | 39991988 |
| Molecular Formula | C16H21Cl2NO2S |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-cycloheptyl-2-[(S)-(2,4-dichlorophenyl)methylsulfinyl]acetamide |
| SMILES | O=C(C[S@@](=O)Cc1ccc(Cl)cc1Cl)NC1CCCCCC1 |
| InChI | InChI=1S/C16H21Cl2NO2S/c17-13-8-7-12(15(18)9-13)10-22(21)11-16(20)19-14-5-3-1-2-4-6-14/h7-9,14H,1-6,10-11H2,(H,19,20)/t22-/m0/s1 |
| InChIKey | PSOGKDOUPAYASY-QFIPXVFZSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |