C22H17Cl2FN2O3 — CID 42709410
N-[2-(2,4-dichlorophenyl)ethyl]-N-[(2-fluorophenyl)methyl]-4-nitrobenzamide (PubChem CID 42709410) has the molecular formula C22H17Cl2FN2O3 and a molecular weight of 447.29 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-N-[(2-fluorophenyl)methyl]-4-nitrobenzamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-N-[(2-fluorophenyl)methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42709410 |
| Molecular Formula | C22H17Cl2FN2O3 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-N-[(2-fluorophenyl)methyl]-4-nitrobenzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N(CCc1ccc(Cl)cc1Cl)Cc1ccccc1F |
| InChI | InChI=1S/C22H17Cl2FN2O3/c23-18-8-5-15(20(24)13-18)11-12-26(14-17-3-1-2-4-21(17)25)22(28)16-6-9-19(10-7-16)27(29)30/h1-10,13H,11-12,14H2 |
| InChIKey | RRMIXCAZLHUVHD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|