C20H22Cl2N2O3 — CID 1061069
N-[2-(2,4-dichlorophenyl)ethyl]-2,2-dimethyl-N-[(4-nitrophenyl)methyl]propanamide (PubChem CID 1061069) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2,2-dimethyl-N-[(4-nitrophenyl)methyl]propanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,2-dimethyl-N-[(4-nitrophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 1061069 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,2-dimethyl-N-[(4-nitrophenyl)methyl]propanamide |
| SMILES | CC(C)(C)C(=O)N(CCc1ccc(Cl)cc1Cl)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22Cl2N2O3/c1-20(2,3)19(25)23(11-10-15-6-7-16(21)12-18(15)22)13-14-4-8-17(9-5-14)24(26)27/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | XCWXYNMDYAGCEQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|