C19H19Cl4NO2 — CID 42657339
2,2-dichloro-N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-ethoxyphenyl)methyl]acetamide (PubChem CID 42657339) has the molecular formula C19H19Cl4NO2 and a molecular weight of 435.18 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-ethoxyphenyl)methyl]acetamide.
| Compound Name | 2,2-dichloro-N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-ethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 42657339 |
| Molecular Formula | C19H19Cl4NO2 |
| Molecular Weight | 435.18 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 2,2-dichloro-N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-ethoxyphenyl)methyl]acetamide |
| SMILES | CCOc1ccc(CN(CCc2ccc(Cl)cc2Cl)C(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H19Cl4NO2/c1-2-26-16-7-3-13(4-8-16)12-24(19(25)18(22)23)10-9-14-5-6-15(20)11-17(14)21/h3-8,11,18H,2,9-10,12H2,1H3 |
| InChIKey | QTYCNGWOMWHFGV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.18 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|